C18H24BF2NO4 — CID 175921275
3-(1,1-difluoro-4-methylpentan-3-yl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-benzoxazol-2-one (PubChem CID 175921275) has the molecular formula C18H24BF2NO4 and a molecular weight of 367.20 g/mol. Its IUPAC name is 3-(1,1-difluoro-4-methylpentan-3-yl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-benzoxazol-2-one.
| Compound Name | 3-(1,1-difluoro-4-methylpentan-3-yl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 175921275 |
| Molecular Formula | C18H24BF2NO4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-(1,1-difluoro-4-methylpentan-3-yl)-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-benzoxazol-2-one |
| SMILES | CC(C)C(CC(F)F)n1c(=O)oc2cccc(B3OCC(C)(C)CO3)c21 |
| InChI | InChI=1S/C18H24BF2NO4/c1-11(2)13(8-15(20)21)22-16-12(6-5-7-14(16)26-17(22)23)19-24-9-18(3,4)10-25-19/h5-7,11,13,15H,8-10H2,1-4H3 |
| InChIKey | XYPNCTYATWFJNR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|