C32H35N7O4 — CID 175921879
6-[[5-[3-(1-azabicyclo[2.2.2]octan-4-yl)-1,2,4-oxadiazol-5-yl]-4-[[(1S)-2-hydroxy-1-phenylethyl]amino]pyrimidin-2-yl]amino]-3,4-dimethyl-3,4-dihydroisochromen-1-one (PubChem CID 175921879) has the molecular formula C32H35N7O4 and a molecular weight of 581.68 g/mol. Its IUPAC name is 6-[[5-[3-(1-azabicyclo[2.2.2]octan-4-yl)-1,2,4-oxadiazol-5-yl]-4-[[(1S)-2-hydroxy-1-phenylethyl]amino]pyrimidin-2-yl]amino]-3,4-dimethyl-3,4-dihydroisochromen-1-one.
| Compound Name | 6-[[5-[3-(1-azabicyclo[2.2.2]octan-4-yl)-1,2,4-oxadiazol-5-yl]-4-[[(1S)-2-hydroxy-1-phenylethyl]amino]pyrimidin-2-yl]amino]-3,4-dimethyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 175921879 |
| Molecular Formula | C32H35N7O4 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 6-[[5-[3-(1-azabicyclo[2.2.2]octan-4-yl)-1,2,4-oxadiazol-5-yl]-4-[[(1S)-2-hydroxy-1-phenylethyl]amino]pyrimidin-2-yl]amino]-3,4-dimethyl-3,4-dihydroisochromen-1-one |
| SMILES | CC1OC(=O)c2ccc(Nc3ncc(-c4nc(C56CCN(CC5)CC6)no4)c(N[C@H](CO)c4ccccc4)n3)cc2C1C |
| InChI | InChI=1S/C32H35N7O4/c1-19-20(2)42-29(41)23-9-8-22(16-24(19)23)34-31-33-17-25(27(36-31)35-26(18-40)21-6-4-3-5-7-21)28-37-30(38-43-28)32-10-13-39(14-11-32)15-12-32/h3-9,16-17,19-20,26,40H,10-15,18H2,1-2H3,(H2,33,34,35,36)/t19?,20?,26-/m1/s1 |
| InChIKey | WKKJAEZVUIFYQK-XYVRPBRGSA-N |
| XLogP | 4.82 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |