C16H14F3NO2 — CID 175922059
(2,3,5-trifluorophenyl)methyl 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 175922059) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is (2,3,5-trifluorophenyl)methyl 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (2,3,5-trifluorophenyl)methyl 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 175922059 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2,3,5-trifluorophenyl)methyl 3-[(Z)-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(/C=C\C#N)C1C(=O)OCc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C16H14F3NO2/c1-16(2)11(4-3-5-20)13(16)15(21)22-8-9-6-10(17)7-12(18)14(9)19/h3-4,6-7,11,13H,8H2,1-2H3/b4-3- |
| InChIKey | XIWWPMYAUBDALL-ARJAWSKDSA-N |
| XLogP | 3.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|