C34H30FN3O3S — CID 175923824
2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide (PubChem CID 175923824) has the molecular formula C34H30FN3O3S and a molecular weight of 579.70 g/mol. Its IUPAC name is 2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide.
| Compound Name | 2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175923824 |
| Molecular Formula | C34H30FN3O3S |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)c1cccc(-c2nc(-c3ccc4c(c3)CCNC4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C34H30FN3O3S/c1-20(34(36)39)21-4-3-5-23(16-21)32-30(27-9-8-26(35)18-29(27)41-14-13-40-2)33-28(11-15-42-33)31(38-32)24-6-7-25-19-37-12-10-22(25)17-24/h3-9,11,15-18,37H,1,10,12-14,19H2,2H3,(H2,36,39) |
| InChIKey | QFTYGJFZVLSCNV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|