C21H21NO2 — CID 175924524
5'-benzylspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione (PubChem CID 175924524) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 5'-benzylspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione.
| Compound Name | 5'-benzylspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 175924524 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 5'-benzylspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione |
| SMILES | O=C1NC(=O)C2(CCCCC2)c2c(Cc3ccccc3)cccc21 |
| InChI | InChI=1S/C21H21NO2/c23-19-17-11-7-10-16(14-15-8-3-1-4-9-15)18(17)21(20(24)22-19)12-5-2-6-13-21/h1,3-4,7-11H,2,5-6,12-14H2,(H,22,23,24) |
| InChIKey | DLZYAOUQVBVIJJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|