C11H10Cl2N2O2 — CID 175924918
2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-1-(4-chlorophenyl)-1-deuterioethanol (PubChem CID 175924918) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 274.13 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-1-(4-chlorophenyl)-1-deuterioethanol.
| Compound Name | 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-1-(4-chlorophenyl)-1-deuterioethanol |
|---|---|
| PubChem CID | 175924918 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-1-(4-chlorophenyl)-1-deuterioethanol |
| SMILES | [2H]C(O)(Cc1noc(CCl)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-6-11-14-10(15-17-11)5-9(16)7-1-3-8(13)4-2-7/h1-4,9,16H,5-6H2/i9D |
| InChIKey | BUVPXWRNZBTZCW-QOWOAITPSA-N |
| XLogP | 2.74 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|