C13H16LiN2O2 — CID 175926008
CID 175926008 (PubChem CID 175926008) has the molecular formula C13H16LiN2O2 and a molecular weight of 239.22 g/mol.
| Compound Name | CID 175926008 |
|---|---|
| PubChem CID | 175926008 |
| Molecular Formula | C13H16LiN2O2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | — |
| SMILES | CN(C)CCn1ccc2cc(C(=O)O)ccc21.[Li] |
| InChI | InChI=1S/C13H16N2O2.Li/c1-14(2)7-8-15-6-5-10-9-11(13(16)17)3-4-12(10)15;/h3-6,9H,7-8H2,1-2H3,(H,16,17); |
| InChIKey | WINCAHFSTIIYQS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |