About N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide
N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide (PubChem CID 175926159) has the molecular formula C10H10N4O3
and a molecular weight of 234.22 g/mol. Its IUPAC name is N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide |
| PubChem CID | 175926159 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide |
| SMILES | CON(C)C(=O)c1nc(-c2cnccn2)co1 |
| InChI | InChI=1S/C10H10N4O3/c1-14(16-2)10(15)9-13-8(6-17-9)7-5-11-3-4-12-7/h3-6H,1-2H3 |
| InChIKey | UIWFMUIYGUGMTQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide?
The IUPAC name of N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide (CID 175926159) is N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide.
What is the SMILES notation for N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide?
The canonical SMILES for N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide is CON(C)C(=O)c1nc(-c2cnccn2)co1.
What is the InChIKey of N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide?
The InChIKey is UIWFMUIYGUGMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O3/c1-14(16-2)10(15)9-13-8(6-17-9)7-5-11-3-4-12-7/h3-6H,1-2H3.
What are the key properties of N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide?
N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide has a molecular weight of 234.22 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methyl-4-pyrazin-2-yl-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 175926159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).