C11H10O4 — CID 175926732
4-(1,2-dihydroxyethyl)chromen-2-one (PubChem CID 175926732) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-(1,2-dihydroxyethyl)chromen-2-one.
| Compound Name | 4-(1,2-dihydroxyethyl)chromen-2-one |
|---|---|
| PubChem CID | 175926732 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4-(1,2-dihydroxyethyl)chromen-2-one |
| SMILES | O=c1cc(C(O)CO)c2ccccc2o1 |
| InChI | InChI=1S/C11H10O4/c12-6-9(13)8-5-11(14)15-10-4-2-1-3-7(8)10/h1-5,9,12-13H,6H2 |
| InChIKey | FVPFAHPPNDMETB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|