C54H82O3 — CID 175926999
3,5-ditert-butyl-4-[[3-[(4-hydroxyphenyl)methyl]-2,4,6-trimethyl-5-[(2,2,6,6-tetratert-butyl-4-hydroxycyclohex-3-en-1-yl)methyl]phenyl]methyl]phenol (PubChem CID 175926999) has the molecular formula C54H82O3 and a molecular weight of 779.25 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-[[3-[(4-hydroxyphenyl)methyl]-2,4,6-trimethyl-5-[(2,2,6,6-tetratert-butyl-4-hydroxycyclohex-3-en-1-yl)methyl]phenyl]methyl]phenol.
| Compound Name | 3,5-ditert-butyl-4-[[3-[(4-hydroxyphenyl)methyl]-2,4,6-trimethyl-5-[(2,2,6,6-tetratert-butyl-4-hydroxycyclohex-3-en-1-yl)methyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 175926999 |
| Molecular Formula | C54H82O3 |
| Molecular Weight | 779.25 g/mol |
| Exact Mass | 778.63 |
| IUPAC Name | 3,5-ditert-butyl-4-[[3-[(4-hydroxyphenyl)methyl]-2,4,6-trimethyl-5-[(2,2,6,6-tetratert-butyl-4-hydroxycyclohex-3-en-1-yl)methyl]phenyl]methyl]phenol |
| SMILES | Cc1c(Cc2ccc(O)cc2)c(C)c(CC2C(C(C)(C)C)(C(C)(C)C)C=C(O)CC2(C(C)(C)C)C(C)(C)C)c(C)c1Cc1c(C(C)(C)C)cc(O)cc1C(C)(C)C |
| InChI | InChI=1S/C54H82O3/c1-33-40(26-36-22-24-37(55)25-23-36)34(2)42(35(3)41(33)29-43-44(47(4,5)6)27-38(56)28-45(43)48(7,8)9)30-46-53(49(10,11)12,50(13,14)15)31-39(57)32-54(46,51(16,17)18)52(19,20)21/h22-25,27-28,31,46,55-57H,26,29-30,32H2,1-21H3 |
| InChIKey | LMYVZEWTMIGYHQ-UHFFFAOYSA-N |
| XLogP | 14.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.25 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |