C27H29N3O2 — CID 175927118
2-[4-[4-(1-adamantyl)phenyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 175927118) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)phenyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[4-[4-(1-adamantyl)phenyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 175927118 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)phenyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cn2cc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)nn2)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-32-24-8-4-22(5-9-24)26(31)17-30-16-25(28-29-30)21-2-6-23(7-3-21)27-13-18-10-19(14-27)12-20(11-18)15-27/h2-9,16,18-20H,10-15,17H2,1H3 |
| InChIKey | YFQWMOSVGMIUCX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |