C29H32N4O7 — CID 175927385
(2S)-2-[[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoyl]amino]carbamoylamino]-4-methylpentanoic acid (PubChem CID 175927385) has the molecular formula C29H32N4O7 and a molecular weight of 548.60 g/mol. Its IUPAC name is (2S)-2-[[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoyl]amino]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoyl]amino]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175927385 |
| Molecular Formula | C29H32N4O7 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (2S)-2-[[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoyl]amino]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)NNC(=O)[C@@H](Cc1ccco1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C29H32N4O7/c1-17(2)14-25(27(35)36)30-28(37)33-32-26(34)24(15-18-8-7-13-39-18)31-29(38)40-16-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)23/h3-13,17,23-25H,14-16H2,1-2H3,(H,31,38)(H,32,34)(H,35,36)(H2,30,33,37)/t24-,25+/m1/s1 |
| InChIKey | CPUBNRPTUDWYNE-RPBOFIJWSA-N |
| XLogP | 3.56 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|