C11H20N2O2 — CID 175928246
2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-3-hydroxybutanamide (PubChem CID 175928246) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-3-hydroxybutanamide.
| Compound Name | 2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 175928246 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-3-hydroxybutanamide |
| SMILES | CC(O)C(C(N)=O)C1C[C@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C11H20N2O2/c1-6(14)10(11(12)15)7-4-8-2-3-9(5-7)13-8/h6-10,13-14H,2-5H2,1H3,(H2,12,15)/t6?,7?,8-,9+,10? |
| InChIKey | IRFXHYDGTMFNPK-FTKOINSTSA-N |
| XLogP | -0.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |