C5HF9O — CID 175928451
(4S,5S)-2,2,3,3,4,5-hexafluoro-5-(trifluoromethyl)oxolane (PubChem CID 175928451) has the molecular formula C5HF9O and a molecular weight of 248.04 g/mol. Its IUPAC name is (4S,5S)-2,2,3,3,4,5-hexafluoro-5-(trifluoromethyl)oxolane.
| Compound Name | (4S,5S)-2,2,3,3,4,5-hexafluoro-5-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 175928451 |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.04 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | (4S,5S)-2,2,3,3,4,5-hexafluoro-5-(trifluoromethyl)oxolane |
| SMILES | F[C@@H]1C(F)(F)C(F)(F)O[C@@]1(F)C(F)(F)F |
| InChI | InChI=1S/C5HF9O/c6-1-2(7,8)5(13,14)15-3(1,9)4(10,11)12/h1H/t1-,3-/m1/s1 |
| InChIKey | IXOKEJCHTLSFIM-NPKIIWCNSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.04 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|