C6H11N3 — CID 175930748
1,2,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-amine (PubChem CID 175930748) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,2,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-amine.
| Compound Name | 1,2,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-amine |
|---|---|
| PubChem CID | 175930748 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1,2,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-amine |
| SMILES | NC1NCC2CNC=C21 |
| InChI | InChI=1S/C6H11N3/c7-6-5-3-8-1-4(5)2-9-6/h3-4,6,8-9H,1-2,7H2 |
| InChIKey | WWJKHWYYPHIPTR-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |