C13H17N3O — CID 175931249
(4-pyrazolo[3,4-c]pyridin-2-ylcyclohexyl)methanol (PubChem CID 175931249) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is (4-pyrazolo[3,4-c]pyridin-2-ylcyclohexyl)methanol.
| Compound Name | (4-pyrazolo[3,4-c]pyridin-2-ylcyclohexyl)methanol |
|---|---|
| PubChem CID | 175931249 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (4-pyrazolo[3,4-c]pyridin-2-ylcyclohexyl)methanol |
| SMILES | OCC1CCC(n2cc3ccncc3n2)CC1 |
| InChI | InChI=1S/C13H17N3O/c17-9-10-1-3-12(4-2-10)16-8-11-5-6-14-7-13(11)15-16/h5-8,10,12,17H,1-4,9H2 |
| InChIKey | BNLREXFOPOGEPB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |