C22H22ClF2N3O4 — CID 175931674
(2S,3S,4S)-N-(5-chloro-2,4-difluorophenyl)-1-(4-cyclopropyl-6-methyl-2-pyridinyl)-3,4-dihydroxy-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 175931674) has the molecular formula C22H22ClF2N3O4 and a molecular weight of 465.88 g/mol. Its IUPAC name is (2S,3S,4S)-N-(5-chloro-2,4-difluorophenyl)-1-(4-cyclopropyl-6-methyl-2-pyridinyl)-3,4-dihydroxy-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S,3S,4S)-N-(5-chloro-2,4-difluorophenyl)-1-(4-cyclopropyl-6-methyl-2-pyridinyl)-3,4-dihydroxy-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175931674 |
| Molecular Formula | C22H22ClF2N3O4 |
| Molecular Weight | 465.88 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (2S,3S,4S)-N-(5-chloro-2,4-difluorophenyl)-1-(4-cyclopropyl-6-methyl-2-pyridinyl)-3,4-dihydroxy-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C2CC2)cc(N2C(=O)[C@@](C)(O)[C@@H](O)[C@H]2C(=O)N(C)c2cc(Cl)c(F)cc2F)n1 |
| InChI | InChI=1S/C22H22ClF2N3O4/c1-10-6-12(11-4-5-11)7-17(26-10)28-18(19(29)22(2,32)21(28)31)20(30)27(3)16-8-13(23)14(24)9-15(16)25/h6-9,11,18-19,29,32H,4-5H2,1-3H3/t18-,19-,22-/m0/s1 |
| InChIKey | ZOQRAUHOPVUAKP-IPJJNNNSSA-N |
| XLogP | 2.69 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.88 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|