C15H15BrF4N2O4S — CID 175932979
6-[(3-bromo-2,5-difluorophenyl)methyl]-7-(difluoromethylsulfonylamino)-5-azaspiro[2.4]heptane-5-carboxylic acid (PubChem CID 175932979) has the molecular formula C15H15BrF4N2O4S and a molecular weight of 475.26 g/mol. Its IUPAC name is 6-[(3-bromo-2,5-difluorophenyl)methyl]-7-(difluoromethylsulfonylamino)-5-azaspiro[2.4]heptane-5-carboxylic acid.
| Compound Name | 6-[(3-bromo-2,5-difluorophenyl)methyl]-7-(difluoromethylsulfonylamino)-5-azaspiro[2.4]heptane-5-carboxylic acid |
|---|---|
| PubChem CID | 175932979 |
| Molecular Formula | C15H15BrF4N2O4S |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 6-[(3-bromo-2,5-difluorophenyl)methyl]-7-(difluoromethylsulfonylamino)-5-azaspiro[2.4]heptane-5-carboxylic acid |
| SMILES | O=C(O)N1CC2(CC2)C(NS(=O)(=O)C(F)F)C1Cc1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C15H15BrF4N2O4S/c16-9-5-8(17)3-7(11(9)18)4-10-12(21-27(25,26)13(19)20)15(1-2-15)6-22(10)14(23)24/h3,5,10,12-13,21H,1-2,4,6H2,(H,23,24) |
| InChIKey | CKPZQHDWPSGAJV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|