C10H16F3N3O3S — CID 175933003
7-(difluoromethylsulfonylamino)-N-[(1S)-1-fluoroethyl]-5-azaspiro[2.4]heptane-5-carboxamide (PubChem CID 175933003) has the molecular formula C10H16F3N3O3S and a molecular weight of 315.32 g/mol. Its IUPAC name is 7-(difluoromethylsulfonylamino)-N-[(1S)-1-fluoroethyl]-5-azaspiro[2.4]heptane-5-carboxamide.
| Compound Name | 7-(difluoromethylsulfonylamino)-N-[(1S)-1-fluoroethyl]-5-azaspiro[2.4]heptane-5-carboxamide |
|---|---|
| PubChem CID | 175933003 |
| Molecular Formula | C10H16F3N3O3S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 7-(difluoromethylsulfonylamino)-N-[(1S)-1-fluoroethyl]-5-azaspiro[2.4]heptane-5-carboxamide |
| SMILES | C[C@H](F)NC(=O)N1CC(NS(=O)(=O)C(F)F)C2(CC2)C1 |
| InChI | InChI=1S/C10H16F3N3O3S/c1-6(11)14-9(17)16-4-7(10(5-16)2-3-10)15-20(18,19)8(12)13/h6-8,15H,2-5H2,1H3,(H,14,17)/t6-,7?/m1/s1 |
| InChIKey | AXOWMYSVNREDAM-ULUSZKPHSA-N |
| XLogP | 0.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|