About 2-benzyl-1H-imidazole;methanedithioic acid
2-benzyl-1H-imidazole;methanedithioic acid (PubChem CID 175933096) has the molecular formula C11H12N2S2
and a molecular weight of 236.37 g/mol. Its IUPAC name is 2-benzyl-1H-imidazole;methanedithioic acid.
Molecular Properties
| Compound Name | 2-benzyl-1H-imidazole;methanedithioic acid |
| PubChem CID | 175933096 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-benzyl-1H-imidazole;methanedithioic acid |
| SMILES | S=CS.c1ccc(Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C10H10N2.CH2S2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;2-1-3/h1-7H,8H2,(H,11,12);1H,(H,2,3) |
| InChIKey | LDLVTMJDSUFLBU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1H-imidazole;methanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-imidazole;methanedithioic acid?
The IUPAC name of 2-benzyl-1H-imidazole;methanedithioic acid (CID 175933096) is 2-benzyl-1H-imidazole;methanedithioic acid.
What is the SMILES notation for 2-benzyl-1H-imidazole;methanedithioic acid?
The canonical SMILES for 2-benzyl-1H-imidazole;methanedithioic acid is S=CS.c1ccc(Cc2ncc[nH]2)cc1.
What is the InChIKey of 2-benzyl-1H-imidazole;methanedithioic acid?
The InChIKey is LDLVTMJDSUFLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.CH2S2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;2-1-3/h1-7H,8H2,(H,11,12);1H,(H,2,3).
What are the key properties of 2-benzyl-1H-imidazole;methanedithioic acid?
2-benzyl-1H-imidazole;methanedithioic acid has a molecular weight of 236.37 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-imidazole;methanedithioic acid is sourced from PubChem (CID 175933096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).