C23H34FN5O3 — CID 175933151
tert-butyl (2S,5S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 175933151) has the molecular formula C23H34FN5O3 and a molecular weight of 447.56 g/mol. Its IUPAC name is tert-butyl (2S,5S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175933151 |
| Molecular Formula | C23H34FN5O3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | tert-butyl (2S,5S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(C(=O)NN=C(N)C2CC2)c2ccc(F)cc2)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34FN5O3/c1-14-13-29(22(31)32-23(3,4)5)15(2)12-28(14)19(16-8-10-18(24)11-9-16)21(30)27-26-20(25)17-6-7-17/h8-11,14-15,17,19H,6-7,12-13H2,1-5H3,(H2,25,26)(H,27,30)/t14-,15-,19?/m0/s1 |
| InChIKey | PPXCGKBYMQNFFW-YIYRCGFGSA-N |
| XLogP | 2.99 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|