About ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate
ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate (PubChem CID 175933161) has the molecular formula C20H31FN2O3
and a molecular weight of 366.48 g/mol. Its IUPAC name is ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate |
| PubChem CID | 175933161 |
| Molecular Formula | C20H31FN2O3 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate |
| SMILES | CCOC(=O)C(c1ccc(F)cc1)N1C[C@H](C)N(C(C)(C)C)C[C@H]1CO |
| InChI | InChI=1S/C20H31FN2O3/c1-6-26-19(25)18(15-7-9-16(21)10-8-15)22-11-14(2)23(20(3,4)5)12-17(22)13-24/h7-10,14,17-18,24H,6,11-13H2,1-5H3/t14-,17-,18?/m0/s1 |
| InChIKey | HTPSOSCJLIUWHD-LNJPMGEZSA-N |
| XLogP | 2.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate?
The IUPAC name of ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate (CID 175933161) is ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate.
What is the SMILES notation for ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate?
The canonical SMILES for ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate is CCOC(=O)C(c1ccc(F)cc1)N1C[C@H](C)N(C(C)(C)C)C[C@H]1CO.
What is the InChIKey of ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate?
The InChIKey is HTPSOSCJLIUWHD-LNJPMGEZSA-N. The full InChI is InChI=1S/C20H31FN2O3/c1-6-26-19(25)18(15-7-9-16(21)10-8-15)22-11-14(2)23(20(3,4)5)12-17(22)13-24/h7-10,14,17-18,24H,6,11-13H2,1-5H3/t14-,17-,18?/m0/s1.
What are the key properties of ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate?
ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate has a molecular weight of 366.48 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2S,5S)-4-tert-butyl-2-(hydroxymethyl)-5-methylpiperazin-1-yl]-2-(4-fluorophenyl)acetate is sourced from PubChem (CID 175933161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).