About 3-arsofuran-2,5-dione
3-arsofuran-2,5-dione (PubChem CID 175933443) has the molecular formula C4HAsO5
and a molecular weight of 203.97 g/mol. Its IUPAC name is 3-arsofuran-2,5-dione.
Molecular Properties
| Compound Name | 3-arsofuran-2,5-dione |
| PubChem CID | 175933443 |
| Molecular Formula | C4HAsO5 |
| Molecular Weight | 203.97 g/mol |
| Exact Mass | 203.90 |
| IUPAC Name | 3-arsofuran-2,5-dione |
| SMILES | O=C1C=C([As](=O)=O)C(=O)O1 |
| InChI | InChI=1S/C4HAsO5/c6-3-1-2(5(8)9)4(7)10-3/h1H |
| InChIKey | GXPDTIIGSOOJTG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.97 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-arsofuran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-arsofuran-2,5-dione?
The IUPAC name of 3-arsofuran-2,5-dione (CID 175933443) is 3-arsofuran-2,5-dione.
What is the SMILES notation for 3-arsofuran-2,5-dione?
The canonical SMILES for 3-arsofuran-2,5-dione is O=C1C=C([As](=O)=O)C(=O)O1.
What is the InChIKey of 3-arsofuran-2,5-dione?
The InChIKey is GXPDTIIGSOOJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HAsO5/c6-3-1-2(5(8)9)4(7)10-3/h1H.
What are the key properties of 3-arsofuran-2,5-dione?
3-arsofuran-2,5-dione has a molecular weight of 203.97 g/mol, XLogP of -1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-arsofuran-2,5-dione is sourced from PubChem (CID 175933443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).