About 1,10-difluoro-1,10-phenanthroline
1,10-difluoro-1,10-phenanthroline (PubChem CID 175933835) has the molecular formula C12H8F2N2
and a molecular weight of 218.21 g/mol. Its IUPAC name is 1,10-difluoro-1,10-phenanthroline.
Molecular Properties
| Compound Name | 1,10-difluoro-1,10-phenanthroline |
| PubChem CID | 175933835 |
| Molecular Formula | C12H8F2N2 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1,10-difluoro-1,10-phenanthroline |
| SMILES | FN1C=CC=c2ccc3c(c21)N(F)C=CC=3 |
| InChI | InChI=1S/C12H8F2N2/c13-15-7-1-3-9-5-6-10-4-2-8-16(14)12(10)11(9)15/h1-8H |
| InChIKey | OXWXXZSOWGXNET-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,10-difluoro-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-difluoro-1,10-phenanthroline?
The IUPAC name of 1,10-difluoro-1,10-phenanthroline (CID 175933835) is 1,10-difluoro-1,10-phenanthroline.
What is the SMILES notation for 1,10-difluoro-1,10-phenanthroline?
The canonical SMILES for 1,10-difluoro-1,10-phenanthroline is FN1C=CC=c2ccc3c(c21)N(F)C=CC=3.
What is the InChIKey of 1,10-difluoro-1,10-phenanthroline?
The InChIKey is OXWXXZSOWGXNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2/c13-15-7-1-3-9-5-6-10-4-2-8-16(14)12(10)11(9)15/h1-8H.
What are the key properties of 1,10-difluoro-1,10-phenanthroline?
1,10-difluoro-1,10-phenanthroline has a molecular weight of 218.21 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-difluoro-1,10-phenanthroline is sourced from PubChem (CID 175933835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).