About methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine
methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine (PubChem CID 175934051) has the molecular formula C10H25N3O8S4
and a molecular weight of 443.59 g/mol. Its IUPAC name is methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine.
Molecular Properties
| Compound Name | methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine |
| PubChem CID | 175934051 |
| Molecular Formula | C10H25N3O8S4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCNCC=C.CS(=O)(=O)CS(N)(=O)=O.CS(=O)(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C6H11N.2C2H7NO4S2/c1-3-5-7-6-4-2;2*1-8(4,5)2-9(3,6)7/h3-4,7H,1-2,5-6H2;2*2H2,1H3,(H2,3,6,7) |
| InChIKey | ODZGSHQPBCKZDL-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 200.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine?
The IUPAC name of methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine (CID 175934051) is methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine.
What is the SMILES notation for methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine?
The canonical SMILES for methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine is C=CCNCC=C.CS(=O)(=O)CS(N)(=O)=O.CS(=O)(=O)CS(N)(=O)=O.
What is the InChIKey of methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine?
The InChIKey is ODZGSHQPBCKZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.2C2H7NO4S2/c1-3-5-7-6-4-2;2*1-8(4,5)2-9(3,6)7/h3-4,7H,1-2,5-6H2;2*2H2,1H3,(H2,3,6,7).
What are the key properties of methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine?
methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine has a molecular weight of 443.59 g/mol, XLogP of -2.50, 8 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfonylmethanesulfonamide;N-prop-2-enylprop-2-en-1-amine is sourced from PubChem (CID 175934051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).