About (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium
(E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium (PubChem CID 175934632) has the molecular formula C25H20O2S2
and a molecular weight of 416.57 g/mol. Its IUPAC name is (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium.
Molecular Properties
| Compound Name | (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium |
| PubChem CID | 175934632 |
| Molecular Formula | C25H20O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium |
| SMILES | O=C([O-])/C=C/c1ccsc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C7H6O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-7(9)2-1-6-3-4-10-5-6/h1-15H;1-5H,(H,8,9)/q+1;/p-1/b;2-1+ |
| InChIKey | UXTWRYWWWPSWQY-WLHGVMLRSA-M |
| XLogP | 5.29 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium?
The IUPAC name of (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium (CID 175934632) is (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium.
What is the SMILES notation for (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium?
The canonical SMILES for (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium is O=C([O-])/C=C/c1ccsc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium?
The InChIKey is UXTWRYWWWPSWQY-WLHGVMLRSA-M. The full InChI is InChI=1S/C18H15S.C7H6O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-7(9)2-1-6-3-4-10-5-6/h1-15H;1-5H,(H,8,9)/q+1;/p-1/b;2-1+.
What are the key properties of (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium?
(E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium has a molecular weight of 416.57 g/mol, XLogP of 5.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-thiophen-3-ylprop-2-enoate;triphenylsulfanium is sourced from PubChem (CID 175934632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).