About 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline
6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline (PubChem CID 175935426) has the molecular formula C17H13NS
and a molecular weight of 263.37 g/mol. Its IUPAC name is 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline |
| PubChem CID | 175935426 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline |
| SMILES | C1=NCCc2cc(-c3ccc4sccc4c3)ccc21 |
| InChI | InChI=1S/C17H13NS/c1-2-16-11-18-7-5-14(16)9-12(1)13-3-4-17-15(10-13)6-8-19-17/h1-4,6,8-11H,5,7H2 |
| InChIKey | MUVAMTVNJPPRKS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline?
The IUPAC name of 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline (CID 175935426) is 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline?
The canonical SMILES for 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline is C1=NCCc2cc(-c3ccc4sccc4c3)ccc21.
What is the InChIKey of 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline?
The InChIKey is MUVAMTVNJPPRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NS/c1-2-16-11-18-7-5-14(16)9-12(1)13-3-4-17-15(10-13)6-8-19-17/h1-4,6,8-11H,5,7H2.
What are the key properties of 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline?
6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline has a molecular weight of 263.37 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-benzothiophen-5-yl)-3,4-dihydroisoquinoline is sourced from PubChem (CID 175935426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).