About methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate
methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate (PubChem CID 175935669) has the molecular formula C15H12F2N2O4
and a molecular weight of 322.27 g/mol. Its IUPAC name is methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate |
| PubChem CID | 175935669 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c(C(=O)NCc2ccc(F)cc2F)c[nH]1 |
| InChI | InChI=1S/C15H12F2N2O4/c1-23-15(22)12-5-13(20)10(7-18-12)14(21)19-6-8-2-3-9(16)4-11(8)17/h2-5,7H,6H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | MVGJAGVTOVFBIJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate?
The IUPAC name of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate (CID 175935669) is methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate?
The canonical SMILES for methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate is COC(=O)c1cc(=O)c(C(=O)NCc2ccc(F)cc2F)c[nH]1.
What is the InChIKey of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate?
The InChIKey is MVGJAGVTOVFBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O4/c1-23-15(22)12-5-13(20)10(7-18-12)14(21)19-6-8-2-3-9(16)4-11(8)17/h2-5,7H,6H2,1H3,(H,18,20)(H,19,21).
What are the key properties of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate?
methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate has a molecular weight of 322.27 g/mol, XLogP of 1.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-1H-pyridine-2-carboxylate is sourced from PubChem (CID 175935669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).