C18H22N4O3 — CID 175936197
[2-(3,5,6-trimethylpyrazin-2-yl)acetyl] 2-(3,5,6-trimethylpyrazin-2-yl)acetate (PubChem CID 175936197) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is [2-(3,5,6-trimethylpyrazin-2-yl)acetyl] 2-(3,5,6-trimethylpyrazin-2-yl)acetate.
| Compound Name | [2-(3,5,6-trimethylpyrazin-2-yl)acetyl] 2-(3,5,6-trimethylpyrazin-2-yl)acetate |
|---|---|
| PubChem CID | 175936197 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [2-(3,5,6-trimethylpyrazin-2-yl)acetyl] 2-(3,5,6-trimethylpyrazin-2-yl)acetate |
| SMILES | Cc1nc(C)c(CC(=O)OC(=O)Cc2nc(C)c(C)nc2C)nc1C |
| InChI | InChI=1S/C18H22N4O3/c1-9-11(3)21-15(13(5)19-9)7-17(23)25-18(24)8-16-14(6)20-10(2)12(4)22-16/h7-8H2,1-6H3 |
| InChIKey | CDZFNHZGYMDMEE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|