C18H14N2O3S — CID 175936245
6-methylimino-5-(3-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one (PubChem CID 175936245) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-methylimino-5-(3-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one.
| Compound Name | 6-methylimino-5-(3-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one |
|---|---|
| PubChem CID | 175936245 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 6-methylimino-5-(3-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one |
| SMILES | C/N=C1\C(=O)c2cccc3c2C(=C1c1cccc(C)c1)NS3(=O)=O |
| InChI | InChI=1S/C18H14N2O3S/c1-10-5-3-6-11(9-10)14-16-15-12(18(21)17(14)19-2)7-4-8-13(15)24(22,23)20-16/h3-9,20H,1-2H3/b19-17- |
| InChIKey | ZULDVIMXNIGUBR-ZPHPHTNESA-N |
| XLogP | 2.42 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|