About cuban-1-yl phosphono hydrogen phosphate
cuban-1-yl phosphono hydrogen phosphate (PubChem CID 175936336) has the molecular formula C8H10O7P2
and a molecular weight of 280.11 g/mol. Its IUPAC name is cuban-1-yl phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | cuban-1-yl phosphono hydrogen phosphate |
| PubChem CID | 175936336 |
| Molecular Formula | C8H10O7P2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | cuban-1-yl phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OC12C3C4C5C3C1C5C42 |
| InChI | InChI=1S/C8H10O7P2/c9-16(10,11)15-17(12,13)14-8-5-2-1-3(5)7(8)4(1)6(2)8/h1-7H,(H,12,13)(H2,9,10,11) |
| InChIKey | KNOWEIHNVBZESR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cuban-1-yl phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cuban-1-yl phosphono hydrogen phosphate?
The IUPAC name of cuban-1-yl phosphono hydrogen phosphate (CID 175936336) is cuban-1-yl phosphono hydrogen phosphate.
What is the SMILES notation for cuban-1-yl phosphono hydrogen phosphate?
The canonical SMILES for cuban-1-yl phosphono hydrogen phosphate is O=P(O)(O)OP(=O)(O)OC12C3C4C5C3C1C5C42.
What is the InChIKey of cuban-1-yl phosphono hydrogen phosphate?
The InChIKey is KNOWEIHNVBZESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O7P2/c9-16(10,11)15-17(12,13)14-8-5-2-1-3(5)7(8)4(1)6(2)8/h1-7H,(H,12,13)(H2,9,10,11).
What are the key properties of cuban-1-yl phosphono hydrogen phosphate?
cuban-1-yl phosphono hydrogen phosphate has a molecular weight of 280.11 g/mol, XLogP of 0.33, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cuban-1-yl phosphono hydrogen phosphate is sourced from PubChem (CID 175936336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).