C14H14N2O3S — CID 175936449
5-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-1H-indole-7-carboxamide (PubChem CID 175936449) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-1H-indole-7-carboxamide.
| Compound Name | 5-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 175936449 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(C2=CCS(=O)(=O)CC2)cc2cc[nH]c12 |
| InChI | InChI=1S/C14H14N2O3S/c15-14(17)12-8-11(7-10-1-4-16-13(10)12)9-2-5-20(18,19)6-3-9/h1-2,4,7-8,16H,3,5-6H2,(H2,15,17) |
| InChIKey | ZWVYXPDTLCRKLI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |