C8H11N3 — CID 175936889
3,4,8,8a-tetrahydroquinoxalin-5-amine (PubChem CID 175936889) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 3,4,8,8a-tetrahydroquinoxalin-5-amine.
| Compound Name | 3,4,8,8a-tetrahydroquinoxalin-5-amine |
|---|---|
| PubChem CID | 175936889 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3,4,8,8a-tetrahydroquinoxalin-5-amine |
| SMILES | NC1=C2NCC=NC2CC=C1 |
| InChI | InChI=1S/C8H11N3/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-2,4,7,11H,3,5,9H2 |
| InChIKey | IGQVNEUWKJFFMR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |