About (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine
(2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine (PubChem CID 175937051) has the molecular formula C11H25N3O2S
and a molecular weight of 263.41 g/mol. Its IUPAC name is (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine.
Molecular Properties
| Compound Name | (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine |
| PubChem CID | 175937051 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine |
| SMILES | C1CNCCN1.C=CC[C@H](C)[C@@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C7H15NO2S.C4H10N2/c1-4-5-6(2)7(3)11(8,9)10;1-2-6-4-3-5-1/h4,6-7H,1,5H2,2-3H3,(H2,8,9,10);5-6H,1-4H2/t6-,7+;/m0./s1 |
| InChIKey | WLSYDLMZFUVTBO-UOERWJHTSA-N |
| XLogP | 0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine?
The IUPAC name of (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine (CID 175937051) is (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine.
What is the SMILES notation for (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine?
The canonical SMILES for (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine is C1CNCCN1.C=CC[C@H](C)[C@@H](C)S(N)(=O)=O.
What is the InChIKey of (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine?
The InChIKey is WLSYDLMZFUVTBO-UOERWJHTSA-N. The full InChI is InChI=1S/C7H15NO2S.C4H10N2/c1-4-5-6(2)7(3)11(8,9)10;1-2-6-4-3-5-1/h4,6-7H,1,5H2,2-3H3,(H2,8,9,10);5-6H,1-4H2/t6-,7+;/m0./s1.
What are the key properties of (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine?
(2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine has a molecular weight of 263.41 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-methylhex-5-ene-2-sulfonamide;piperazine is sourced from PubChem (CID 175937051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).