C24H24FN5O6 — CID 175937745
5-(2-azidoethoxymethyl)-2-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 175937745) has the molecular formula C24H24FN5O6 and a molecular weight of 497.48 g/mol. Its IUPAC name is 5-(2-azidoethoxymethyl)-2-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | 5-(2-azidoethoxymethyl)-2-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 175937745 |
| Molecular Formula | C24H24FN5O6 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 5-(2-azidoethoxymethyl)-2-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | [N-]=[N+]=NCCOCC12CC(C(=O)O)N(C(=O)CNC(=O)c3ccc(Oc4ccc(F)cc4)cc3)C1C2 |
| InChI | InChI=1S/C24H24FN5O6/c25-16-3-7-18(8-4-16)36-17-5-1-15(2-6-17)22(32)27-13-21(31)30-19(23(33)34)11-24(12-20(24)30)14-35-10-9-28-29-26/h1-8,19-20H,9-14H2,(H,27,32)(H,33,34) |
| InChIKey | PKKDQZVQXMAXEN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 153.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|