C50H99N3O4 — CID 175937845
2-[6-[(7-carboxy-7-hexylpentadecyl)-(2-piperazin-1-ylethyl)amino]hexyl]-2-hexyldecanoic acid (PubChem CID 175937845) has the molecular formula C50H99N3O4 and a molecular weight of 806.36 g/mol. Its IUPAC name is 2-[6-[(7-carboxy-7-hexylpentadecyl)-(2-piperazin-1-ylethyl)amino]hexyl]-2-hexyldecanoic acid.
| Compound Name | 2-[6-[(7-carboxy-7-hexylpentadecyl)-(2-piperazin-1-ylethyl)amino]hexyl]-2-hexyldecanoic acid |
|---|---|
| PubChem CID | 175937845 |
| Molecular Formula | C50H99N3O4 |
| Molecular Weight | 806.36 g/mol |
| Exact Mass | 805.76 |
| IUPAC Name | 2-[6-[(7-carboxy-7-hexylpentadecyl)-(2-piperazin-1-ylethyl)amino]hexyl]-2-hexyldecanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)(CCCCCCN(CCCCCCC(CCCCCC)(CCCCCCCC)C(=O)O)CCN1CCNCC1)C(=O)O |
| InChI | InChI=1S/C50H99N3O4/c1-5-9-13-17-19-27-35-49(47(54)55,33-25-15-11-7-3)37-29-21-23-31-41-52(45-46-53-43-39-51-40-44-53)42-32-24-22-30-38-50(48(56)57,34-26-16-12-8-4)36-28-20-18-14-10-6-2/h51H,5-46H2,1-4H3,(H,54,55)(H,56,57) |
| InChIKey | SRECVBFMHADFGV-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.36 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|