C27H25F4N3 — CID 175937999
N-[[4-[2,3,5,6-tetrafluoro-4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]cyclohexanamine (PubChem CID 175937999) has the molecular formula C27H25F4N3 and a molecular weight of 467.51 g/mol. Its IUPAC name is N-[[4-[2,3,5,6-tetrafluoro-4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]cyclohexanamine.
| Compound Name | N-[[4-[2,3,5,6-tetrafluoro-4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 175937999 |
| Molecular Formula | C27H25F4N3 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[[4-[2,3,5,6-tetrafluoro-4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]cyclohexanamine |
| SMILES | Cc1nc2ccc(-c3c(F)c(F)c(-c4ccc(CNC5CCCCC5)cc4)c(F)c3F)cc2[nH]1 |
| InChI | InChI=1S/C27H25F4N3/c1-15-33-20-12-11-18(13-21(20)34-15)23-26(30)24(28)22(25(29)27(23)31)17-9-7-16(8-10-17)14-32-19-5-3-2-4-6-19/h7-13,19,32H,2-6,14H2,1H3,(H,33,34) |
| InChIKey | KXFZBVQQXCWXAW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|