C25H25N3O — CID 175938025
(3R)-1-[[2-[4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]pyrrolidin-3-ol (PubChem CID 175938025) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is (3R)-1-[[2-[4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[[2-[4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 175938025 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (3R)-1-[[2-[4-(2-methyl-3H-benzimidazol-5-yl)phenyl]phenyl]methyl]pyrrolidin-3-ol |
| SMILES | Cc1nc2ccc(-c3ccc(-c4ccccc4CN4CC[C@@H](O)C4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C25H25N3O/c1-17-26-24-11-10-20(14-25(24)27-17)18-6-8-19(9-7-18)23-5-3-2-4-21(23)15-28-13-12-22(29)16-28/h2-11,14,22,29H,12-13,15-16H2,1H3,(H,26,27)/t22-/m1/s1 |
| InChIKey | NXMGHCAVMDIOCH-JOCHJYFZSA-N |
| XLogP | 4.77 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |