C58H58CuN4O3+2 — CID 175938319
copper 5-[4-(5,5-dimethyl-1,3-dioxan-2-yl)-2,5-diethylphenyl]-15-(furan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 175938319) has the molecular formula C58H58CuN4O3+2 and a molecular weight of 922.67 g/mol. Its IUPAC name is copper 5-[4-(5,5-dimethyl-1,3-dioxan-2-yl)-2,5-diethylphenyl]-15-(furan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | copper 5-[4-(5,5-dimethyl-1,3-dioxan-2-yl)-2,5-diethylphenyl]-15-(furan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 175938319 |
| Molecular Formula | C58H58CuN4O3+2 |
| Molecular Weight | 922.67 g/mol |
| Exact Mass | 921.38 |
| IUPAC Name | copper 5-[4-(5,5-dimethyl-1,3-dioxan-2-yl)-2,5-diethylphenyl]-15-(furan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | CCc1cc(C2OCC(C)(C)CO2)c(CC)cc1-c1c2nc(c(-c3c(C)cc(C)cc3C)c3ccc([nH]3)c(-c3ccco3)c3nc(c(-c4c(C)cc(C)cc4C)c4ccc1[nH]4)C=C3)C=C2.[Cu+2] |
| InChI | InChI=1S/C58H58N4O3.Cu/c1-11-38-29-41(57-64-30-58(9,10)31-65-57)39(12-2)28-40(38)53-42-15-19-46(59-42)55(51-34(5)24-32(3)25-35(51)6)48-21-17-44(61-48)54(50-14-13-23-63-50)45-18-22-49(62-45)56(47-20-16-43(53)60-47)52-36(7)26-33(4)27-37(52)8;/h13-29,57,59,62H,11-12,30-31H2,1-10H3;/q;+2/b53-42-,53-43-,54-44+,54-45+,55-46+,55-48+,56-47+,56-49+; |
| InChIKey | BZYMXOPYMRKJBE-VQBFWKBGSA-N |
| XLogP | 14.96 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.67 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |