C11H21N3O5 — CID 175938398
(2S,3S)-2-[2-[(1S)-4-amino-1-carboxy-4-oxobutyl]hydrazinyl]-3-methylpentanoic acid (PubChem CID 175938398) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2S,3S)-2-[2-[(1S)-4-amino-1-carboxy-4-oxobutyl]hydrazinyl]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[2-[(1S)-4-amino-1-carboxy-4-oxobutyl]hydrazinyl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 175938398 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2S,3S)-2-[2-[(1S)-4-amino-1-carboxy-4-oxobutyl]hydrazinyl]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NN[C@@H](CCC(N)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-3-6(2)9(11(18)19)14-13-7(10(16)17)4-5-8(12)15/h6-7,9,13-14H,3-5H2,1-2H3,(H2,12,15)(H,16,17)(H,18,19)/t6-,7-,9-/m0/s1 |
| InChIKey | NPBHGIUNBLTMOL-ZKWXMUAHSA-N |
| XLogP | -0.70 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|