About 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine
2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 175939118) has the molecular formula C13H18N6
and a molecular weight of 258.33 g/mol. Its IUPAC name is 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 175939118 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CC1(C)CN(c2nc(N)c3ncccc3n2)CCN1 |
| InChI | InChI=1S/C13H18N6/c1-13(2)8-19(7-6-16-13)12-17-9-4-3-5-15-10(9)11(14)18-12/h3-5,16H,6-8H2,1-2H3,(H2,14,17,18) |
| InChIKey | JXLLTJNTYXZVTJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine (CID 175939118) is 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine is CC1(C)CN(c2nc(N)c3ncccc3n2)CCN1.
What is the InChIKey of 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is JXLLTJNTYXZVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6/c1-13(2)8-19(7-6-16-13)12-17-9-4-3-5-15-10(9)11(14)18-12/h3-5,16H,6-8H2,1-2H3,(H2,14,17,18).
What are the key properties of 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine?
2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 258.33 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 175939118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).