C25H45N7O9S — CID 175940153
(2S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid (PubChem CID 175940153) has the molecular formula C25H45N7O9S and a molecular weight of 619.74 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 175940153 |
| Molecular Formula | C25H45N7O9S |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (2S)-2-[[(2S)-5-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)O)C(C)C |
| InChI | InChI=1S/C25H45N7O9S/c1-13(2)20(32-21(36)14(27)9-11-42-3)24(39)30-15(6-4-5-10-26)22(37)29-16(7-8-18(28)33)23(38)31-17(25(40)41)12-19(34)35/h13-17,20H,4-12,26-27H2,1-3H3,(H2,28,33)(H,29,37)(H,30,39)(H,31,38)(H,32,36)(H,34,35)(H,40,41)/t14-,15-,16-,17-,20-/m0/s1 |
| InChIKey | VEEYPUFFMYHEOR-LLYLOPHFSA-N |
| XLogP | -2.38 |
| TPSA | 286.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|