About 2-butyl-7-fluoro-1,3-benzothiazole
2-butyl-7-fluoro-1,3-benzothiazole (PubChem CID 175941310) has the molecular formula C11H12FNS
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-butyl-7-fluoro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-butyl-7-fluoro-1,3-benzothiazole |
| PubChem CID | 175941310 |
| Molecular Formula | C11H12FNS |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-butyl-7-fluoro-1,3-benzothiazole |
| SMILES | CCCCc1nc2cccc(F)c2s1 |
| InChI | InChI=1S/C11H12FNS/c1-2-3-7-10-13-9-6-4-5-8(12)11(9)14-10/h4-6H,2-3,7H2,1H3 |
| InChIKey | IWNRLNUQWSDBLR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-7-fluoro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-7-fluoro-1,3-benzothiazole?
The IUPAC name of 2-butyl-7-fluoro-1,3-benzothiazole (CID 175941310) is 2-butyl-7-fluoro-1,3-benzothiazole.
What is the SMILES notation for 2-butyl-7-fluoro-1,3-benzothiazole?
The canonical SMILES for 2-butyl-7-fluoro-1,3-benzothiazole is CCCCc1nc2cccc(F)c2s1.
What is the InChIKey of 2-butyl-7-fluoro-1,3-benzothiazole?
The InChIKey is IWNRLNUQWSDBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNS/c1-2-3-7-10-13-9-6-4-5-8(12)11(9)14-10/h4-6H,2-3,7H2,1H3.
What are the key properties of 2-butyl-7-fluoro-1,3-benzothiazole?
2-butyl-7-fluoro-1,3-benzothiazole has a molecular weight of 209.29 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-7-fluoro-1,3-benzothiazole is sourced from PubChem (CID 175941310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).