C12H6BrClF3NO — CID 175941451
2-bromo-6-[(4-chloro-2-fluorophenyl)methoxy]-3,5-difluoropyridine (PubChem CID 175941451) has the molecular formula C12H6BrClF3NO and a molecular weight of 352.54 g/mol. Its IUPAC name is 2-bromo-6-[(4-chloro-2-fluorophenyl)methoxy]-3,5-difluoropyridine.
| Compound Name | 2-bromo-6-[(4-chloro-2-fluorophenyl)methoxy]-3,5-difluoropyridine |
|---|---|
| PubChem CID | 175941451 |
| Molecular Formula | C12H6BrClF3NO |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2-bromo-6-[(4-chloro-2-fluorophenyl)methoxy]-3,5-difluoropyridine |
| SMILES | Fc1cc(Cl)ccc1COc1nc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H6BrClF3NO/c13-11-9(16)4-10(17)12(18-11)19-5-6-1-2-7(14)3-8(6)15/h1-4H,5H2 |
| InChIKey | BEZAWDQRUGMRDD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|