About 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene]
6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] (PubChem CID 175941979) has the molecular formula C16H12ClNO
and a molecular weight of 269.73 g/mol. Its IUPAC name is 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene].
Molecular Properties
| Compound Name | 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] |
| PubChem CID | 175941979 |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] |
| SMILES | Clc1ccc2c(c1)C=COC21NCc2ccccc21 |
| InChI | InChI=1S/C16H12ClNO/c17-13-5-6-15-11(9-13)7-8-19-16(15)14-4-2-1-3-12(14)10-18-16/h1-9,18H,10H2 |
| InChIKey | KQDQSTUIPAESRN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene]?
The IUPAC name of 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] (CID 175941979) is 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene].
What is the SMILES notation for 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene]?
The canonical SMILES for 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] is Clc1ccc2c(c1)C=COC21NCc2ccccc21.
What is the InChIKey of 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene]?
The InChIKey is KQDQSTUIPAESRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO/c17-13-5-6-15-11(9-13)7-8-19-16(15)14-4-2-1-3-12(14)10-18-16/h1-9,18H,10H2.
What are the key properties of 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene]?
6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] has a molecular weight of 269.73 g/mol, XLogP of 3.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-chlorospiro[1,2-dihydroisoindole-3,1'-isochromene] is sourced from PubChem (CID 175941979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).