C20H23N7O — CID 175942089
(8aR)-2-[3-amino-4-(4-aminophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 175942089) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is (8aR)-2-[3-amino-4-(4-aminophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | (8aR)-2-[3-amino-4-(4-aminophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 175942089 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (8aR)-2-[3-amino-4-(4-aminophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | Cn1nc(N)c2c(-c3ccc(N)cc3)cc(N3CCN4C(=O)CC[C@@H]4C3)nc21 |
| InChI | InChI=1S/C20H23N7O/c1-25-20-18(19(22)24-25)15(12-2-4-13(21)5-3-12)10-16(23-20)26-8-9-27-14(11-26)6-7-17(27)28/h2-5,10,14H,6-9,11,21H2,1H3,(H2,22,24)/t14-/m1/s1 |
| InChIKey | XQJHRPXVCFPWCI-CQSZACIVSA-N |
| XLogP | 1.61 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|