C16H14Cl2FN5O4 — CID 175942299
6-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-2-(fluoromethyl)-1,2,4-triazine-3,5-dione (PubChem CID 175942299) has the molecular formula C16H14Cl2FN5O4 and a molecular weight of 430.22 g/mol. Its IUPAC name is 6-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-2-(fluoromethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-2-(fluoromethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 175942299 |
| Molecular Formula | C16H14Cl2FN5O4 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 6-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-2-(fluoromethyl)-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)n1nc(Cc2c(Cl)cc(-c3nn(CF)c(=O)[nH]c3=O)cc2Cl)oc1=O |
| InChI | InChI=1S/C16H14Cl2FN5O4/c1-7(2)24-16(27)28-12(21-24)5-9-10(17)3-8(4-11(9)18)13-14(25)20-15(26)23(6-19)22-13/h3-4,7H,5-6H2,1-2H3,(H,20,25,26) |
| InChIKey | VJFVAMVCFUZWCC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |