C45H57OP — CID 175942472
bis(3,5-ditert-butylphenyl)-[(3R)-spiro[1,2-dihydroindene-3,4'-2,3-dihydrochromene]-4-yl]phosphane (PubChem CID 175942472) has the molecular formula C45H57OP and a molecular weight of 644.92 g/mol. Its IUPAC name is bis(3,5-ditert-butylphenyl)-[(3R)-spiro[1,2-dihydroindene-3,4'-2,3-dihydrochromene]-4-yl]phosphane.
| Compound Name | bis(3,5-ditert-butylphenyl)-[(3R)-spiro[1,2-dihydroindene-3,4'-2,3-dihydrochromene]-4-yl]phosphane |
|---|---|
| PubChem CID | 175942472 |
| Molecular Formula | C45H57OP |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | bis(3,5-ditert-butylphenyl)-[(3R)-spiro[1,2-dihydroindene-3,4'-2,3-dihydrochromene]-4-yl]phosphane |
| SMILES | CC(C)(C)c1cc(P(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cccc3c2[C@@]2(CCOc4ccccc42)CC3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H57OP/c1-41(2,3)31-24-32(42(4,5)6)27-35(26-31)47(36-28-33(43(7,8)9)25-34(29-36)44(10,11)12)39-19-15-16-30-20-21-45(40(30)39)22-23-46-38-18-14-13-17-37(38)45/h13-19,24-29H,20-23H2,1-12H3/t45-/m1/s1 |
| InChIKey | AHLBOJPTCUFRQJ-WBVITSLISA-N |
| XLogP | 10.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|