C14H15N3O — CID 175942730
N-deuterio-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 175942730) has the molecular formula C14H15N3O and a molecular weight of 242.30 g/mol. Its IUPAC name is N-deuterio-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-deuterio-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 175942730 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-deuterio-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | [2H]NC(=O)c1n[nH]c2c1CC(c1ccccc1)CC2 |
| InChI | InChI=1S/C14H15N3O/c15-14(18)13-11-8-10(6-7-12(11)16-17-13)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,15,18)(H,16,17)/i/hD |
| InChIKey | WMDRWJOKVRIKPZ-DYCDLGHISA-N |
| XLogP | 1.78 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |