About 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine
5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine (PubChem CID 175943641) has the molecular formula C16H13F3N4O
and a molecular weight of 334.30 g/mol. Its IUPAC name is 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine.
Molecular Properties
| Compound Name | 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine |
| PubChem CID | 175943641 |
| Molecular Formula | C16H13F3N4O |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine |
| SMILES | Cc1ncc(C2=CCN=CC2)c(Oc2ccc(C(F)(F)F)nc2)n1 |
| InChI | InChI=1S/C16H13F3N4O/c1-10-21-9-13(11-4-6-20-7-5-11)15(23-10)24-12-2-3-14(22-8-12)16(17,18)19/h2-4,7-9H,5-6H2,1H3 |
| InChIKey | PGFWCMDUJBGPME-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine?
The IUPAC name of 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine (CID 175943641) is 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine.
What is the SMILES notation for 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine?
The canonical SMILES for 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine is Cc1ncc(C2=CCN=CC2)c(Oc2ccc(C(F)(F)F)nc2)n1.
What is the InChIKey of 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine?
The InChIKey is PGFWCMDUJBGPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N4O/c1-10-21-9-13(11-4-6-20-7-5-11)15(23-10)24-12-2-3-14(22-8-12)16(17,18)19/h2-4,7-9H,5-6H2,1H3.
What are the key properties of 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine?
5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine has a molecular weight of 334.30 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dihydropyridin-4-yl)-2-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]pyrimidine is sourced from PubChem (CID 175943641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).